17β-Estradiol-17-valerate-[d4]
17β-Estradiol-17-pentanoate-[d4] is the labelled analogue of 17β-Estradiol-17-pentanoate, which is a derivative of Estradiol. Estradiol is the major estrogen secreted by the premenopausal ovary. Estrogens direct the development of the female genotype in embryogenesis and at puberty.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-001807 |
| Pricing | Inquire |
| Molecular Weight | 360.52 |
| Molecular Formula | C23H28D4O3 |
| Canonical SMILES | CCCCC(=O)OC1CCC2C1(CCC3C2CCC4=C3C=CC(=C4)O)C |