EGFR/ErbB2 Inhibitor
EGFR/ErbB2 inhibitor is a cell-permeable 4-anilino quinazoline compound, which is a potent and reversible inhibitor of EGFR and c-ErbB2 (IC50s = 20 and 79 nM, respectively). It inhibits the proliferation of cancer cells overexpressing either c-ErbB2 or EGFR (IC50s = 2.3-2.5 µM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 179248-61-4 |
| Pricing | Inquire |
| Cas | 179248-61-4 |
| Molecular Weight | 387.4 |
| Molecular Formula | C23H21N3O3 |
| Canonical SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=C(C=C3)OCC4=CC=CC=C4)OC |