2'-b-C-Methyl-3-deazauridine
2'-b-C-Methyl-3-deazauridine is a potential antiviral and anticancer agent. It is a prodrug of the active metabolite 2'-C-methylguanosine, which can be incorporated into viral RNA or DNA leading to inhibition of viral replication. Additionally, 2'-b-C-Methyl-3-deazauridine has been shown to inhibit tumor growth in vitro and in vivo and has potential as a chemotherapy drug for various types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 622379-93-5 |
| Pricing | Inquire |
| Cas | 622379-93-5 |
| Molecular Weight | 257.24 |
| Molecular Formula | C11H15NO6 |
| Canonical SMILES | CC1(C(C(OC1N2C=CC(=CC2=O)O)CO)O)O |