4-METHYLBENZYLZINC CHLORIDE
4-METHYLBENZYLZINC CHLORIDE is an essential biomedical product utilized in the pharmaceutical industry. It serves as a reactant in the synthesis of various drugs, particularly those used for the treatment of neurological disorders and cancer. With its unique chemical properties, this compound plays a crucial role in drug development and research for improved therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 312693-21-3 |
| Pricing | Inquire |
| Cas | 312693-21-3 |
| Molecular Weight | 206 |
| Molecular Formula | C8H9ClZn |
| Canonical SMILES | CC1=CC=C(C=C1)[CH2-].Cl[Zn+] |