Benzyl 2-(2-hydroxyethoxy)ethylcarbamate
Benzyl 2-(2-hydroxyethoxy)ethylcarbamate is a chemical compound used in organic synthesis and pharmaceutical research. This compound is often utilized as a protecting group in organic chemistry reactions, particularly in the synthesis of various pharmaceutical intermediates and active compounds. The benzyl group can be selectively removed under mild conditions, allowing for controlled functionalization of the hydroxyethoxyethyl carbamate moiety. This versatility makes it valuable in the development of new drugs and in the modification of existing drug molecules.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB077791 |
| Pricing | Inquire |
| Cas | 145881-74-9 |
| Molecular Weight | 239.27 |
| Molecular Formula | C12H17NO4 |
| Canonical SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCO |