Fmoc-D-Glu-OH
N-Fmoc-D-glutamic acid is an N-Fmoc-protected form of D-Glutamic acid. D-Glutamic Acid is the unnatural (R)-enantiomer of Glutamic Acid, a non-essential amino acid. Its salt form (glutamate) is an important neurotransmitter that plays a key role in long-term potentiation and is important for learning and memory. Glutamic Acid is also a key molecule in cellular metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003720 |
| Pricing | Inquire |
| Cas | 104091-09-0 |
| Molecular Weight | 369.38 |
| Molecular Formula | C20H19NO6 |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCC(=O)O)C(=O)O |