Omeprazole EP Impurity F
Omeprazole EP Impurity F is an impurity of Omeprazole. Omeprazole is a proton pump inhibitor used in the treatment of dyspepsia. It binds to the proton pump hydrogen-potassium adenosine triphosphatase (H+/K+ ATPase) and inhibits its activity and the parietal cell secretion of H+ ions into the gastric lumen.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0139-478372 |
| Pricing | Inquire |
| Cas | 125656-82-8 |
| Molecular Weight | 311.36 |
| Molecular Formula | C16H13N3O2S |
| Canonical SMILES | CC1=CN2C(=C(C1=O)C)C(=S)N3C2=NC4=C3C=CC(=C4)OC |