Aranochlor B
Aranochlor B is an antibiotic produced by Pseudoarachniotus roseus (HIL Y-30499). It has activity against gram-positive bacteria such as Staphylococcus aureus, Bacillus subtilis and Micrococcus luteus and Saccharomyces cerevisiae. No effect on other Gram-negative bacteria and fungi.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00068 |
| Pricing | Inquire |
| Molecular Weight | 437.96 |
| Molecular Formula | C23H32ClNO5 |
| Canonical SMILES | CCCCCCC(C)C=C(C)C=CC(=O)NC1CC2(C=C(C(=O)C3C2O3)Cl)OC1O |