Fluorogenic Human CMV Protease Substrate
Fluorogenic Human CMV Protease Substrate, the FRET substrate, is used to develop a fluorescence-based detection method for human cytomegalovirus proteinase. It specifically cleaves on the Ala-Ser bond, thereby removing the C-terminal peptide-Edans fragment from the proximity quenching effect of DABCYL groups. This represents the first fluorescence-based assay of the herpes virus protease and allows characterization of potential inhibitors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015134 |
| Pricing | Inquire |
| Cas | 163265-38-1 |
| Molecular Weight | 1628.85 |
| Molecular Formula | C73H109N23O18S |
| Canonical SMILES | CC(C)CC(C(=O)NC(C)C(=O)NCCNC1=CC=CC2=C1C=CC=C2S(=O)(=O)O)NC(=O)C(CCCNC(=N)N)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(C)NC(=O)C(CC(=O)N)NC(=O)C(C(C)C)NC(=O)C(C(C)C)NC(=O)CNC(=O)C(CCCNC(=N)N)NC(=O)C3=CC=C(C=C3)N=NC4=CC=C(C=C4)N(C)C |