2'-Deoxy-N2,N8-di-DMF-5'-O-DMT-guanosine 3'-CE phosphoramidite
2'-Deoxy-N2,N8-di-DMF-5'-O-DMT-guanosine 3'-CE phosphoramidite is acclaimed as a pivotal recompound within the domain of compound, playing an indispensable role in the process of synthesizing altered nucleosides. By virtue of its integration into solid-phase research and development, diverse oligonucleotides can be intricately tailored. Moreover, this extraordinary phosphoramidite facilitates the targeted amendment of DNA or RNA sequences.
| Supplier | BOC Sciences |
|---|---|
| Product # | 166092-91-7 |
| Pricing | Inquire |
| Cas | 166092-91-7 |
| Molecular Weight | 895.02 |
| Molecular Formula | C46H59N10O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C6=C(C(=O)NC(=N6)N=CN(C)C)N=C5N=CN(C)C |