Daunorubicin EP Impurity A
Daunorubicin EP Impurity A is the main metabolite of Daunorubicin, which is an anthracycline antibiotic used in the treatment of acute myeloid and lymphocytic leukemia, with adverse reactions such as cardiotoxicity and bone marrow suppression.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0709-195144 |
| Pricing | Inquire |
| Cas | 21794-55-8 |
| Molecular Weight | 398.37 |
| Molecular Formula | C21H18O8 |
| Canonical SMILES | CC(=O)C1(CC(C2=C(C1)C(=C3C(=C2O)C(=O)C4=C(C3=O)C=CC=C4OC)O)O)O |