1-(4-Chlorophenyl)-3-(4-fluorophenyl)thiourea
1-(4-Chlorophenyl)-3-(4-fluorophenyl)thiourea, a chemical compound widely used in biomedical research, poses significant therapeutic potential against several diseases such as cancer, inflammation and autoimmune disorders. Existing studies have demonstrated the compound's efficacy in thwarting these health conditions. Its multifarious medicinal applications make it an interesting area of further inquiry for the biomedical research community.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0001-284863 |
| Pricing | Inquire |
| Cas | 370-26-3 |
| Molecular Weight | 280.745 |
| Molecular Formula | C13H10ClFN2S |
| Canonical SMILES | C1=CC(=CC=C1NC(=S)NC2=CC=C(C=C2)Cl)F |