7-Deaza-dA CEP
7-Deaza-dA CEP is a crucial compound commonly employed in the research and development of nucleic acids, specifically DNA. This compound aids in the study of DNA-related diseases such as cancer and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 107134-59-8 |
| Pricing | Inquire |
| Cas | 107134-59-8 |
| Molecular Weight | 856.96 |
| Molecular Formula | C48H53N6O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=CC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7 |