Methyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride
Methyl (S)-2-amino-3-(3-(methylsulfonyl)phenyl)propanoate hydrochloride, a compound extensively employed in pharmaceutical research aimed at addressing illnesses like cancer and neurological disorders. Its pharmacological utility arises from its capacity to regulate intricate biological pathways implicated in such maladies, making it a promising therapeutic candidate.
| Supplier | BOC Sciences |
|---|---|
| Product # | 851785-21-2 |
| Pricing | Inquire |
| Cas | 851785-21-2 |
| Molecular Weight | 293.77 |
| Molecular Formula | C11H15NO4S.HCl |
| Canonical SMILES | COC(=O)C(CC1=CC(=CC=C1)S(=O)(=O)C)N.Cl |