Fmoc-L-tyrosine
N-Fmoc-L-tyrosine is an N-Fmoc-protected form of L-Tyrosine. L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines in human keratinocytes, and also for the synthesis of proteins and thyroid hormones.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-003775 |
| Pricing | Inquire |
| Cas | 92954-90-0 |
| Molecular Weight | 403.60 |
| Molecular Formula | C24H21NO5 |
| Canonical SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC=C(C=C4)O)C(=O)O |