5'-O-DMT-2'-O-methyl-N6-phenoxyacetyladenosine
5'-O-DMT-2'-O-methyl-N6-phenoxyacetyladenosine is an immensely powerful biomedical compound, used in the research of inflammatory disorders and autoimmune diseases. This exquisite molecule, through its adept nature, selectively engages receptors and signaling pathways, exuding anti-inflammatory prowess.
| Supplier | BOC Sciences |
|---|---|
| Product # | 128219-81-8 |
| Pricing | Inquire |
| Cas | 128219-81-8 |
| Molecular Weight | 717.77 |
| Molecular Formula | C40H39N5O8 |
| Canonical SMILES | COC1C(C(OC1N2C=NC3=C(N=CN=C32)NC(=O)COC4=CC=CC=C4)COC(C5=CC=CC=C5)(C6=CC=C(C=C6)OC)C7=CC(=CC=C7)OC)O |