2-Amino-6-chloro-9-[(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)]-9H-purine
2-Amino-6-chloro-9-[(2,3,5-tri-O-benzoyl-2-C-methyl-β-D-ribofuranosyl)]-9H-purine, a remarkably potent antiviral and antineoplastic agent, is a key treatment option for specific viral infections and cancer variations. This compound functions through halting the assimilation of viral DNA and RNA, consequently obstructing virus replication, while also bolstering apoptosis within cancer cells, arresting their growth and diffusion.
| Supplier | BOC Sciences |
|---|---|
| Product # | 641571-44-0 |
| Pricing | Inquire |
| Cas | 641571-44-0 |
| Molecular Weight | 628.03 |
| Molecular Formula | C32H26ClN5O7 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=C2N=C(N=C3Cl)N)COC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6 |