2'-Amino-2'-deoxyinosine
2'-Amino-2'-deoxyinosine is a valuable reagent widely used in the biomedicine industry, employed in the development of nucleic acid-based therapies and drugs, such as antisense oligonucleotides, aptamers, and gene therapy. Additionally, it finds applications in the study of various diseases, including cancer, viral infections, and genetic disorders, due to its ability to modify nucleic acid structures.
| Supplier | BOC Sciences |
|---|---|
| Product # | 75763-51-8 |
| Pricing | Inquire |
| Cas | 75763-51-8 |
| Molecular Weight | 267.24 |
| Molecular Formula | C10H13N5O4 |
| Canonical SMILES | C1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)CO)O)N |