2',4'-Dihydroxy-7-methoxy-8-prenylflavan
2',4'-Dihydroxy-7-methoxy-8-prenylflavan is a remarkable natural compound, extensively employed in the research of diverse ailments. Renowned for its robust antioxidant and anti-inflammatory attributes, this natural compound emerges as an efficacious warrior against oxidative stress and alleviates inflammation.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP2258 |
| Pricing | Inquire |
| Cas | 331954-16-6 |
| Molecular Weight | 340.42 |
| Molecular Formula | C21H24O4 |
| Canonical SMILES | CC(=CCC1=C(C=CC2=C1OC(CC2)C3=C(C=C(C=C3)O)O)OC)C |