5'-O-(4,4'-Dimethoxytrityl)-2'-O,4'-C-methylene uridine
5'-O-(4,4'-Dimethoxytrityl)-2'-O,4'-C-methylene uridine, a highly sought-after compound in the biomedical sector, exhibits immense value across numerous applications. Its crucial involvement in nucleoside analog and RNA derivative synthesis renders it indispensable for drug development pertaining to viral infections, cancer therapies, and nucleic acid exploration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 195705-32-9 |
| Pricing | Inquire |
| Cas | 195705-32-9 |
| Molecular Weight | 558.58 |
| Molecular Formula | C31H30N2O8 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC45COC(C4O)C(O5)N6C=CC(=O)NC6=O |