tert-Butyl b-D-glucopyranoside
tert-Butyl b-D-glucopyranoside, a prevalent chemical compound in biomedicine, exhibits multifaceted roles of paramount importance. It functions as a non-reducing carbohydrate in diverse research investigations and pharmaceutical applications. This compound serves as a pivotal glucose source and finds widespread usage in vaccine and biologics manufacture. Moreover, its significance shines through in the examination of cell-surface glycosylation patterns and the glycosidase activities that govern therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 29074-04-2 |
| Pricing | Inquire |
| Cas | 29074-04-2 |
| Molecular Weight | 236.26 |
| Molecular Formula | C10H20O6 |
| Canonical SMILES | CC(C)(C)OC1C(C(C(C(O1)CO)O)O)O |