N-Acetylneuraminic acid 9-phosphate
N-Acetylneuraminic acid 9-phosphate is also known as Neu5Ac-9P, actively participating in the intricate process of sialic acid synthesis, thereby exerting profound effects on the formation and function of glycoproteins and glycolipids.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37992-17-9 |
| Pricing | Inquire |
| Cas | 37992-17-9 |
| Molecular Weight | 389.25 |
| Molecular Formula | C11H20NO12P |
| Canonical SMILES | CC(=O)NC1C(CC(OC1C(C(COP(=O)(O)O)O)O)(C(=O)O)O)O |