[1R-(exo,exo)]-3-(4-Methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylic Acid Methyl Ester
[1R-(exo,exo)]-3-(4-Methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylic Acid Methyl Ester is an intermediate in the synthesis of Fluoroethyl-PE2I (F591758), which is a useful intermediate that is often used in the synthesis of PET ligands that are used for dopamine transporter imaging.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB056392 |
| Pricing | Inquire |
| Cas | 188680-62-8 |
| Molecular Weight | 259.34 |
| Molecular Formula | C16H21NO2 |
| Canonical SMILES | CC1=CC=C(C=C1)C2CC3CCC(C2C(=O)OC)N3 |