Ethinylestradiol sulfate-[d4]
Ethinylestradiol sulfate-[d4] is the labelled analogue of Ethinylestradiol sulfate, which is a derivative of Estradiol. Estradiol​ is the major estrogen secreted by the premenopausal ovary. Estrogens direct the development of the female genotype in embryogenesis and at puberty.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005364 |
| Pricing | Inquire |
| Molecular Weight | 380.49 |
| Molecular Formula | C20H20D4O5S |
| Canonical SMILES | CC12CCC3C(C1CCC2(C#C)O)CCC4=C3C=CC(=C4)OS(=O)(=O)O |