N,N-Dimethylguanosine 5'-Monophosphate
N,N-Dimethylguanosine 5'-Monophosphate is commonly found in eukaryotic tRNA. In addition, the presence of methyl groups on this molecule limits the potential to form proper Watson-Crick base pairing and therefore, it is a useful tool to elucidate molecular events related to post-translational modifications of RNA.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4214-21-5 |
| Pricing | Inquire |
| Cas | 4214-21-5 |
| Molecular Weight | 391.27 |
| Molecular Formula | C12H18N5O8P |
| Canonical SMILES | CN(C)C1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)COP(=O)(O)O)O)O |