Oleoyl oxazolopyridine
Oleoyl oxazolopyridine is a potent inhibitor of fatty acid amide hydrolase (FAAH) with Ki values of 1.3 and 2.3 nM for the human and rat enzymes, respectively. It is approximately 35-fold more potent than oleyl trifluoromethyl ketone when assayed under the same conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 288862-58-8 |
| Pricing | Inquire |
| Cas | 288862-58-8 |
| Molecular Weight | 384.6 |
| Molecular Formula | C24H36N2O2 |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)C1=NC2=C(O1)C=CC=N2 |