NS1-IN-1
NS1-IN-1 (compound 3) is a potent NS1 inhibitor. NS1 is a major influenza A virus virulence factor that inhibits host gene expression. NS1-IN-1 decreases viral protein levels, contributing to the reduction of virus replication. NS1-IN-1 shows antiviral activity by repressing the activity of mTORC1 in a TSC1-TSC2-dependent manner.
| Supplier | BOC Sciences |
|---|---|
| Product # | 181373-35-3 |
| Pricing | Inquire |
| Cas | 181373-35-3 |
| Molecular Weight | 394.46 |
| Molecular Formula | C23H26N2O4 |
| Canonical SMILES | C1CCN(CC1)C2=C3C=CC=C4C3=C(C=C2)C(=O)N(C4=O)CCCCCC(=O)O |