Ustiloxin B
It is originally isolated from Ustilaginoidea virens. Ustiloxin B can inhibit the polymerization of tubulin with an IC50 of 2.8 μmol/L, and it also inhibits mitosis in various human tumor cell lines.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02741 |
| Pricing | Inquire |
| Cas | 151841-41-7 |
| Molecular Weight | 645.68 |
| Molecular Formula | C26H39N5O12S |
| Canonical SMILES | CCC1(C(NC(=O)C(NC(=O)C(C(C2=CC(=C(C=C2S(=O)CC(CC(C(=O)O)N)O)O)O1)O)NC)C)C(=O)NCC(=O)O)C |