3-(3,4-Dimethoxyphenyl)-1-(2-hydroxyphenyl)propan-1-one
3-(3,4-Dimethoxyphenyl)-1-(2-hydroxyphenyl)propan-1-one is an intermediate for the synthesis of dTAG-7 (D710015), which is a degradation tag, was tested for its efficiency at depleting FKBP12F36V -MELK(sg3R) and was found to have significantly degraded FKBP12F36V -MELK(sg3R) within 4 hours.Used in the study of cancer research.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB063198 |
| Pricing | Inquire |
| Cas | 86383-39-3 |
| Molecular Weight | 286.32 |
| Molecular Formula | C17H18O4 |
| Canonical SMILES | COC1=C(C=C(C=C1)CCC(=O)C2=CC=CC=C2O)OC |