Methyl 2,3,4,6-tetra-O-acetyl-b-D-mannopyranoside

Methyl 2,3,4,6-tetra-O-acetyl-β-D-mannopyranoside, known for its pivotal role in biomedical research, emerges as a paramount compound. By faithfully replicating the intricate architecture of specific sugar molecules present on cellular exteriors, it assumes a profound significance. Its unparalleled attributes pave the way for breakthroughs in therapeutics, encompassing an extensive range of afflictions such as cancer, viral infections, and autoimmune ailments.
Supplier BOC Sciences
Product # 5019-25-0
Pricing Inquire
Cas 5019-25-0
Molecular Weight 362.33
Molecular Formula C15H22O10
Canonical SMILES CC(=O)OCC1C(C(C(C(O1)OC)OC(=O)C)OC(=O)C)OC(=O)C
Feedback