4-Nitrophenyl-b-D-arabinopyranoside
4-Nitrophenyl-β-D-arabinopyranoside is a prevalent chemical compound within the biomedical industry, displaying promising capabilities in research of specific ailments such as cancer and bacterial infections. Incapacitating enzymes, this compound adeptly serves as a substrate, facilitating their recognition and quantification in a range of biological specimens.
| Supplier | BOC Sciences |
|---|---|
| Product # | 78679-14-8 |
| Pricing | Inquire |
| Cas | 78679-14-8 |
| Molecular Weight | 271.22 |
| Molecular Formula | C11H13NO7 |
| Canonical SMILES | C1C(C(C(C(O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O |