4-Chloro-1H-pyrrolo[2,3-b]pyridine-5-boronic acid pinacol ester
4-Chloro-1H-pyrrolo[2,3-b]pyridine-5-boronic acid pinacol ester is a key compound used in the biomedical industry. It acts as a building block for the synthesis of pharmaceutical drugs targeting various diseases. Its unique structure enables the development of potential treatments for cancer, inflammation, and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1072145-24-4 |
| Pricing | Inquire |
| Cas | 1072145-24-4 |
| Molecular Weight | 278.55 |
| Molecular Formula | C13H16BClN2O2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C3C(=C2Cl)C=CN3 |