Soyasapogenol B
Soyasapogenol B is a natural triterpenoid found in the seeds of Glycine max, it exhibits the activity of anticomplementary. Soyasapogenol B also has hepatoprotective activity on the hepatotoxicity of tert-butyl
hydroperoxide (t-BuOOH) in a human-liver-derived cell line (HepG2 cells)
hydroperoxide (t-BuOOH) in a human-liver-derived cell line (HepG2 cells)
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6650 |
| Pricing | Inquire |
| Cas | 595-15-3 |
| Molecular Weight | 458.7 |
| Molecular Formula | C30H50O3 |
| Canonical SMILES | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CCC2(C(C1)O)C)C)C)(C)CO)O)C)C |