7-Hydroxy Coumarin-[13C6]
Labelled Umbelliferone. Umbelliferone, which is extracted from the root of Angelica biserrata (Shan et Yuan) Yuan et Shan, also known as 7-hydroxycoumarin, hydrangine, skimmetine, and beta-umbelliferone, is a widespread natural product of the coumarin family. It is a yellowish-white crystalline solid that has a slight solubility in hot water, but high solubility in ethanol.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003129 |
| Pricing | Inquire |
| Cas | 1189992-05-9 |
| Molecular Weight | 168.10 |
| Molecular Formula | C3[13C]6H6O3 |
| Canonical SMILES | C1=CC(=CC2=C1C=CC(=O)O2)O |