2'-O-Allylguanosine
2'-O-Allylguanosine is a nucleoside derivative widely employed in the realm of biomedical research, boasting immense potential for the development of antiviral medications, inclusive of therapeutic solutions targeting HIV, hepatitis C, and sundry viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 133766-28-6 |
| Pricing | Inquire |
| Cas | 133766-28-6 |
| Molecular Weight | 323.30 |
| Molecular Formula | C13H17N5O5 |
| Canonical SMILES | C=CCOC1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)O |