Ethynyl 2-deoxy-5-O-DMT-ribosyl 3-CE phosphoramidite
Ethynyl 2-deoxy-5-O-DMT-ribosyl 3-CE phosphoramidite is an indispensible compound, catering to the synthesis of modified oligonucleotides. Its application in drug R&D facilitates the investigation of nucleic acid interactions and chemical alterations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1173797-55-1 |
| Pricing | Inquire |
| Cas | 1173797-55-1 |
| Molecular Weight | 644.74 |
| Molecular Formula | C37H45N2O6P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)C#C |