SARS-CoV-2-IN-17
SARS-CoV-2-IN-17 (Compound 16) is a potent SARS-CoV-2 nucleocapsid protein (NPro) inhibitor. SARS-CoV-2-IN-17 exhibits potent anti-viral activity with the EC50 of 2.18 μM. SARS-CoV-2-IN-17 binds to NPro with the low KD value of 7.82 μM, suggesting that SARS-CoV-2-IN-17 is a potent NPro ligand.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2761911-44-6 |
| Pricing | Inquire |
| Cas | 2761911-44-6 |
| Molecular Weight | 380.36 |
| Molecular Formula | C19H19F3N2O3 |
| Canonical SMILES | CCN1CC2=CC(=C(C=C2C3=C1C(=CC=C3)NC(=O)C(F)(F)F)OC)OC |