6-(3-Methyl-2-oxobutyroyl)-7-methoxycoumarin
6-(3-Methyl-2-oxobutyroyl)-7-methoxycoumarin is an extraordinarily versatile and vibrant fluorescent dye, garnering immense significance in the field of natural compound. Its invaluable utility as an unrivaled probe for precision labeling and imaging of distinct cellular constituents stands unparalleled.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1002 |
| Pricing | Inquire |
| Cas | 2188162-96-9 |
| Molecular Weight | 274.27 |
| Molecular Formula | C15H14O5 |
| Canonical SMILES | CC(C)C(=O)C(=O)C1=C(C=C2C(=C1)C=CC(=O)O2)OC |