1,5-Anhydro-4,6-O-benzylidene-2,3-dideoxy-2-[uracil-1-yl]-D-glucitol
1,5-Anhydro-4,6-O-benzylidene-2,3-dideoxy-2-[uracil-1-yl]-D-glucitol is a versatile compound used in the biomedical industry. This product plays a crucial role in the development of antiviral drugs targeting uracil-sensitive viruses. Its unique structure offers potential therapeutic applications for treating uracil-related diseases, including viral infections and certain types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 852235-06-4 |
| Pricing | Inquire |
| Cas | 852235-06-4 |
| Molecular Weight | 330.34 |
| Molecular Formula | C17H18N2O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC3C(COC(O3)C4=CC=CC=C4)OC2 |