MK-0493 Free base
MK-0493 is a novel, potent, and selective agonist of the melanocortin receptor 4 (MC4R), one of the best-validated genetic targets and considered one of the most promising for the development of antiobesity therapeutics.
| Supplier | BOC Sciences |
|---|---|
| Product # | 455956-93-1 |
| Pricing | Inquire |
| Cas | 455956-93-1 |
| Molecular Weight | 546.09 |
| Molecular Formula | C30H38ClF2N3O2 |
| Canonical SMILES | C[C@@H](c1cc(ccc1C2CCN(CC2)C(=O)[C@@H]3CN(C[C@H]3c4ccc(cc4F)F)C(C)(C)C)Cl)NC(=O)C |