1,2,3,4-Tetra-O-isobutyryl-b-D-glucuronide methyl ester
1,2,3,4-Tetra-O-isobutyryl-b-D-glucuronide methyl ester, a pivotal compound in the biomedical sector, exhibits profound significance in drug development. Widely employed in the synthesis of medications aimed at combating diverse ailments, this compound's exceptional purity and remarkable stability render it ideal for both laboratory exploration and pharmaceutical advancements.
| Supplier | BOC Sciences |
|---|---|
| Product # | 150607-94-6 |
| Pricing | Inquire |
| Cas | 150607-94-6 |
| Molecular Weight | 488.53 |
| Molecular Formula | C23H36O11 |
| Canonical SMILES | CC(C)C(=O)OC1C(C(OC(C1OC(=O)C(C)C)OC(=O)C(C)C)C(=O)OC)OC(=O)C(C)C |