Metformin EP Impurity B
Metformin EP Impurity B is an impurity of Metformin (HCl), an oral hypoglycemic agent that slows electron transport in the oxidation pathway in mitochondria. Guanylmelamine is a guanidino compound with antitumor activity. It is also a neoplasm inhibitor.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1163-255433 |
| Pricing | Inquire |
| Cas | 4405-08-7 |
| Molecular Weight | 168.16 |
| Molecular Formula | C4H8N8 |
| Canonical SMILES | C1(=NC(=NC(=N1)N=C(N)N)N)N |