E-2-(2 4-DIFLUOROPHENYL)VINYLBORONIC AC&
E-2-(2,4-Difluorophenyl)vinylboronic Acid is an invaluable biomedicine chemical exploring targeted molecular pathways. As a boronic acid derivative, it possesses tremendous potential for diverse applications within the biomedical industry. Within the realm of research and therapeutic development, this compound assumes a significant role as a valuable tool.
| Supplier | BOC Sciences |
|---|---|
| Product # | 736987-78-3 |
| Pricing | Inquire |
| Cas | 736987-78-3 |
| Molecular Weight | 266.093 |
| Molecular Formula | C14H17BF2O2 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C=CC2=C(C=C(C=C2)F)F |