6-a-D-Glucopyranosyl maltotriose
6-a-D-Glucopyranosyl maltotriose, an extensively employed carbohydrate compound within the biomedical industry, plays a fundamental role as a primary building block for developing therapeutic interventions aimed at diverse ailments including, but not limited to, diabetes, cancer, and cardiovascular disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 34336-93-1 |
| Pricing | Inquire |
| Cas | 34336-93-1 |
| Molecular Weight | 666.58 |
| Molecular Formula | C24H42O21 |
| Canonical SMILES | C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3C(OC(C(C3O)O)OC4C(OC(C(C4O)O)O)CO)CO)O)O)O)O)O)O)O |