6-keto-5alpha-hydroxycholesterol
6-keto-5alpha-hydroxycholesterol represents a pivotal step in the intricate pathway of bile acid and steroid hormone production, serving as a vital biomarker in the clinical diagnosis of Smith-Lemli-Opitz syndrome, a genetic anomaly adversely impacting cholesterol homeostasis.
Supplier | BOC Sciences |
---|---|
Product # | 13027-33-3 |
Pricing | Inquire |
Cas | 13027-33-3 |
Molecular Weight | 418.65 |
Molecular Formula | C27H46O3 |
Canonical SMILES | CC(C)CCCC(C)C1CCC2C1(CCC3C2CC(=O)C4(C3(CCC(C4)O)C)O)C |