Mal-PEG12-PFP ester
Mal-PEG12-PFP ester is a PEG linker containing maleimide and PFP moieties. Maleimide is thiol-reactive and reacts between pH 6.5 and 7.5 to form thiol ester bonds. PFP moiety is amine-reactive and is less susceptible to undergoing hydrolysis. The hydrophilic PEG linker increases the water solubility of a compound in aqueous media.
| Supplier | BOC Sciences |
|---|---|
| Product # | BPG-0410 |
| Pricing | Inquire |
| Molecular Weight | 863.82 |
| Molecular Formula | C37H54F5NO16 |
| Canonical SMILES | O=C(OC1=C(F)C(F)=C(F)C(F)=C1F)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN2C(C=CC2=O)=O |