1, 6- Bis(2- sulfanylidene- 1, 3- thiazolidin- 3- yl) hexane- 1, 6- dione
1, 6- Bis(2- sulfanylidene- 1, 3- thiazolidin- 3- yl) hexane- 1, 6- dione is used in the synthesis of macrocyclic polyamides.
Supplier | BOC Sciences |
---|---|
Product # | BB055214 |
Pricing | Inquire |
Cas | 74058-83-6 |
Molecular Weight | 348.53 |
Molecular Formula | C12H16N2O2S4 |
Canonical SMILES | C1CSC(=S)N1C(=O)CCCCC(=O)N2CCSC2=S |