2-Chloro-9-(2,3,5-tri-O-acetyl-β-D-ribofuranosyl)-9H-purine
2-Chloro-9-(2,3,5-tri-O-acetyl-β-D-ribofuranosyl)-9H-purine, a remarkable bioactive entity, holds paramount importance within the biomedical sector. Its indispensability is evidenced by its pivotal contributions to the advancements in antiviral pharmaceuticals, specifically pertinent in combating formidable viral ailments including hepatitis B and C. Capitalizing on its distinctive molecular architecture and inherent characteristics, this compound demonstrates immense promise for precisely targeted therapeutic interventions, elevating its significance within the scientific community.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1260177-41-0 |
| Pricing | Inquire |
| Cas | 1260177-41-0 |
| Molecular Weight | 412.78 |
| Molecular Formula | C16H17ClN4O7 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=NC4=CN=C(N=C43)Cl)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6 |