Auristatin E
Auristatin E is a synthetic analog of dolastatin 10. Auristatin E is a highly potent antimitotic agent.Auristatin E inhibits tubulin polymerization. Auristatin E is a cytotoxic tubulin modifier with potent and selective antitumor activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-00188 |
| Pricing | 5 mg/unit USD $939 |
| Cas | 160800-57-7 |
| Molecular Weight | 732.01 |
| Molecular Formula | C40H69N5O7 |
| Canonical SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(C(C)C(=O)NC(C)C(C2=CC=CC=C2)O)OC)OC)N(C)C(=O)C(C(C)C)NC(=O)C(C(C)C)N(C)C |