(S)-Amino-(3-fluorophenyl)acetic acid
(S)-Amino-(3-fluorophenyl)acetic acid is a chiral amino acid derivative featuring an S-configuration, with an amino group on the second carbon, a 3-fluorophenyl group as its side chain on the third carbon, and a propanoic acid backbone. This structure combines elements of standard amino acids with a fluorinated aromatic ring, making it useful in biochemical research and pharmaceutical development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 154006-66-3 |
| Pricing | Inquire |
| Cas | 154006-66-3 |
| Molecular Weight | 169.15 |
| Molecular Formula | C8H8FNO2 |
| Canonical SMILES | C1=CC(=CC(=C1)F)C(C(=O)O)N |